C14H17NO4S2 — CID 110601518
N-[2-(2,4-dimethoxyphenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 110601518) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110601518 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(CCNS(=O)(=O)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C14H17NO4S2/c1-18-12-6-5-11(13(10-12)19-2)7-8-15-21(16,17)14-4-3-9-20-14/h3-6,9-10,15H,7-8H2,1-2H3 |
| InChIKey | NUGWTPCBEDPAKK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |