C15H19NO4S2 — CID 110408836
N-[2-(2,4-dimethoxyphenyl)ethyl]-5-methylthiophene-2-sulfonamide (PubChem CID 110408836) has the molecular formula C15H19NO4S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)ethyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110408836 |
| Molecular Formula | C15H19NO4S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-5-methylthiophene-2-sulfonamide |
| SMILES | COc1ccc(CCNS(=O)(=O)c2ccc(C)s2)c(OC)c1 |
| InChI | InChI=1S/C15H19NO4S2/c1-11-4-7-15(21-11)22(17,18)16-9-8-12-5-6-13(19-2)10-14(12)20-3/h4-7,10,16H,8-9H2,1-3H3 |
| InChIKey | KUOWHJWZKGYWIA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |