C15H19NO3S2 — CID 87031963
5-ethyl-N-[2-(2-methoxyphenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 87031963) has the molecular formula C15H19NO3S2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 5-ethyl-N-[2-(2-methoxyphenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[2-(2-methoxyphenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 87031963 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 5-ethyl-N-[2-(2-methoxyphenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCc2ccccc2OC)s1 |
| InChI | InChI=1S/C15H19NO3S2/c1-3-13-8-9-15(20-13)21(17,18)16-11-10-12-6-4-5-7-14(12)19-2/h4-9,16H,3,10-11H2,1-2H3 |
| InChIKey | RIWCZZSXWDXDIR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |