C18H20N2O4S2 — CID 110326084
5-ethyl-N-[2-(6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110326084) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-ethyl-N-[2-(6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[2-(6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110326084 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 5-ethyl-N-[2-(6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCc2cc3cc(OC)ccc3[nH]c2=O)s1 |
| InChI | InChI=1S/C18H20N2O4S2/c1-3-15-5-7-17(25-15)26(22,23)19-9-8-12-10-13-11-14(24-2)4-6-16(13)20-18(12)21/h4-7,10-11,19H,3,8-9H2,1-2H3,(H,20,21) |
| InChIKey | CNEWJHOKNUYBNU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |