C16H22N2O3S2 — CID 45003249
N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-5-methylthiophene-2-sulfonamide (PubChem CID 45003249) has the molecular formula C16H22N2O3S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 45003249 |
| Molecular Formula | C16H22N2O3S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-5-methylthiophene-2-sulfonamide |
| SMILES | COc1cccc(C(CNS(=O)(=O)c2ccc(C)s2)N(C)C)c1 |
| InChI | InChI=1S/C16H22N2O3S2/c1-12-8-9-16(22-12)23(19,20)17-11-15(18(2)3)13-6-5-7-14(10-13)21-4/h5-10,15,17H,11H2,1-4H3 |
| InChIKey | STFJEOSFBKKKMX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |