C19H24N2O3S — CID 51169691
(E)-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-2-phenylethenesulfonamide (PubChem CID 51169691) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is (E)-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 51169691 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (E)-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-2-phenylethenesulfonamide |
| SMILES | COc1cccc(C(CNS(=O)(=O)/C=C/c2ccccc2)N(C)C)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-21(2)19(17-10-7-11-18(14-17)24-3)15-20-25(22,23)13-12-16-8-5-4-6-9-16/h4-14,19-20H,15H2,1-3H3/b13-12+ |
| InChIKey | NOIFAWDQISIOFB-OUKQBFOZSA-N |
| XLogP | 2.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |