C16H21NO5S2 — CID 113096502
5-methyl-N-[2-(2,3,5-trimethoxyphenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 113096502) has the molecular formula C16H21NO5S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 5-methyl-N-[2-(2,3,5-trimethoxyphenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[2-(2,3,5-trimethoxyphenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113096502 |
| Molecular Formula | C16H21NO5S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 5-methyl-N-[2-(2,3,5-trimethoxyphenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | COc1cc(CCNS(=O)(=O)c2ccc(C)s2)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H21NO5S2/c1-11-5-6-15(23-11)24(18,19)17-8-7-12-9-13(20-2)10-14(21-3)16(12)22-4/h5-6,9-10,17H,7-8H2,1-4H3 |
| InChIKey | VINCABUBXPGCOP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |