C14H17NO4S2 — CID 87032979
N-[(2,3-dimethoxyphenyl)methyl]-5-methylthiophene-2-sulfonamide (PubChem CID 87032979) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 87032979 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-5-methylthiophene-2-sulfonamide |
| SMILES | COc1cccc(CNS(=O)(=O)c2ccc(C)s2)c1OC |
| InChI | InChI=1S/C14H17NO4S2/c1-10-7-8-13(20-10)21(16,17)15-9-11-5-4-6-12(18-2)14(11)19-3/h4-8,15H,9H2,1-3H3 |
| InChIKey | QEINMHPIARYYIP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |