C20H20N2O5S2 — CID 55578020
N-[(2,4-dimethoxyphenyl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 55578020) has the molecular formula C20H20N2O5S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 55578020 |
| Molecular Formula | C20H20N2O5S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H20N2O5S2/c1-26-17-10-7-15(18(12-17)27-2)13-21-20(23)14-5-8-16(9-6-14)22-29(24,25)19-4-3-11-28-19/h3-12,22H,13H2,1-2H3,(H,21,23) |
| InChIKey | KKVJAIRFBXFUFI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |