C19H16BrN3O5S2 — CID 24982596
N-[4-[[(2-bromo-5-methoxybenzoyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 24982596) has the molecular formula C19H16BrN3O5S2 and a molecular weight of 510.39 g/mol. Its IUPAC name is N-[4-[[(2-bromo-5-methoxybenzoyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[[(2-bromo-5-methoxybenzoyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 24982596 |
| Molecular Formula | C19H16BrN3O5S2 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 508.97 |
| IUPAC Name | N-[4-[[(2-bromo-5-methoxybenzoyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(Br)c(C(=O)NNC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C19H16BrN3O5S2/c1-28-14-8-9-16(20)15(11-14)19(25)22-21-18(24)12-4-6-13(7-5-12)23-30(26,27)17-3-2-10-29-17/h2-11,23H,1H3,(H,21,24)(H,22,25) |
| InChIKey | BGJUKEBVOIAJQI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|