C16H13N5O6S2 — CID 2082661
N-[4-[[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 2082661) has the molecular formula C16H13N5O6S2 and a molecular weight of 435.44 g/mol. Its IUPAC name is N-[4-[[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2082661 |
| Molecular Formula | C16H13N5O6S2 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | N-[4-[[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(NNC(=O)c1cc(=O)[nH]c(=O)[nH]1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H13N5O6S2/c22-12-8-11(17-16(25)18-12)15(24)20-19-14(23)9-3-5-10(6-4-9)21-29(26,27)13-2-1-7-28-13/h1-8,21H,(H,19,23)(H,20,24)(H2,17,18,22,25) |
| InChIKey | AIRJCKLHBAGPRR-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 170.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|