C19H17N3O4S3 — CID 26872757
N-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 26872757) has the molecular formula C19H17N3O4S3 and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 26872757 |
| Molecular Formula | C19H17N3O4S3 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | N-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(NNC(=O)c1cc2c(s1)CCC2)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H17N3O4S3/c23-18(20-21-19(24)16-11-13-3-1-4-15(13)28-16)12-6-8-14(9-7-12)22-29(25,26)17-5-2-10-27-17/h2,5-11,22H,1,3-4H2,(H,20,23)(H,21,24) |
| InChIKey | PUOMZSRKJGZWTL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|