C16H12BrN3O5S2 — CID 4802460
N-[4-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 4802460) has the molecular formula C16H12BrN3O5S2 and a molecular weight of 470.33 g/mol. Its IUPAC name is N-[4-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4802460 |
| Molecular Formula | C16H12BrN3O5S2 |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 468.94 |
| IUPAC Name | N-[4-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(NNC(=O)c1ccc(Br)o1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H12BrN3O5S2/c17-13-8-7-12(25-13)16(22)19-18-15(21)10-3-5-11(6-4-10)20-27(23,24)14-2-1-9-26-14/h1-9,20H,(H,18,21)(H,19,22) |
| InChIKey | RWBMAMCJAXMPKO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|