C20H19N3O4S2 — CID 66617057
N-[4-methoxy-1-[(2-methoxyphenyl)methyl]indazol-3-yl]thiophene-2-sulfonamide (PubChem CID 66617057) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[4-methoxy-1-[(2-methoxyphenyl)methyl]indazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[4-methoxy-1-[(2-methoxyphenyl)methyl]indazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66617057 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | N-[4-methoxy-1-[(2-methoxyphenyl)methyl]indazol-3-yl]thiophene-2-sulfonamide |
| SMILES | COc1ccccc1Cn1nc(NS(=O)(=O)c2cccs2)c2c(OC)cccc21 |
| InChI | InChI=1S/C20H19N3O4S2/c1-26-16-9-4-3-7-14(16)13-23-15-8-5-10-17(27-2)19(15)20(21-23)22-29(24,25)18-11-6-12-28-18/h3-12H,13H2,1-2H3,(H,21,22) |
| InChIKey | JXBIHNSFESABSL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |