C19H13FN4O2S2 — CID 66616938
N-[1-[(3-cyanophenyl)methyl]-4-fluoroindazol-3-yl]thiophene-2-sulfonamide (PubChem CID 66616938) has the molecular formula C19H13FN4O2S2 and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[1-[(3-cyanophenyl)methyl]-4-fluoroindazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[(3-cyanophenyl)methyl]-4-fluoroindazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66616938 |
| Molecular Formula | C19H13FN4O2S2 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N-[1-[(3-cyanophenyl)methyl]-4-fluoroindazol-3-yl]thiophene-2-sulfonamide |
| SMILES | N#Cc1cccc(Cn2nc(NS(=O)(=O)c3cccs3)c3c(F)cccc32)c1 |
| InChI | InChI=1S/C19H13FN4O2S2/c20-15-6-2-7-16-18(15)19(23-28(25,26)17-8-3-9-27-17)22-24(16)12-14-5-1-4-13(10-14)11-21/h1-10H,12H2,(H,22,23) |
| InChIKey | QLRAPCFXXXCBLC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |