About N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide
N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide (PubChem CID 22205934) has the molecular formula C16H17N3O2S2
and a molecular weight of 347.47 g/mol. Its IUPAC name is N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide |
| PubChem CID | 22205934 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(C)n(Cc2cccc(NS(=O)(=O)c3cccs3)c2)n1 |
| InChI | InChI=1S/C16H17N3O2S2/c1-12-9-13(2)19(17-12)11-14-5-3-6-15(10-14)18-23(20,21)16-7-4-8-22-16/h3-10,18H,11H2,1-2H3 |
| InChIKey | UGSKJSNERLBIFN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide?
The IUPAC name of N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide (CID 22205934) is N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide.
What is the SMILES notation for N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide?
The canonical SMILES for N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide is Cc1cc(C)n(Cc2cccc(NS(=O)(=O)c3cccs3)c2)n1.
What is the InChIKey of N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide?
The InChIKey is UGSKJSNERLBIFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2S2/c1-12-9-13(2)19(17-12)11-14-5-3-6-15(10-14)18-23(20,21)16-7-4-8-22-16/h3-10,18H,11H2,1-2H3.
What are the key properties of N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide?
N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide has a molecular weight of 347.47 g/mol, XLogP of 3.41, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]thiophene-2-sulfonamide is sourced from PubChem (CID 22205934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).