C12H14BrNO3S2 — CID 129017405
1-(bromomethyl)-2-methoxybenzene;thiophene-2-sulfonamide (PubChem CID 129017405) has the molecular formula C12H14BrNO3S2 and a molecular weight of 364.29 g/mol. Its IUPAC name is 1-(bromomethyl)-2-methoxybenzene;thiophene-2-sulfonamide.
| Compound Name | 1-(bromomethyl)-2-methoxybenzene;thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 129017405 |
| Molecular Formula | C12H14BrNO3S2 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 1-(bromomethyl)-2-methoxybenzene;thiophene-2-sulfonamide |
| SMILES | COc1ccccc1CBr.NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C8H9BrO.C4H5NO2S2/c1-10-8-5-3-2-4-7(8)6-9;5-9(6,7)4-2-1-3-8-4/h2-5H,6H2,1H3;1-3H,(H2,5,6,7) |
| InChIKey | NRSGEZMIJNMDJN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|