C15H13N3O3S2 — CID 7553601
N-[3-(6-methoxypyridazin-3-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 7553601) has the molecular formula C15H13N3O3S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[3-(6-methoxypyridazin-3-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(6-methoxypyridazin-3-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7553601 |
| Molecular Formula | C15H13N3O3S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-[3-(6-methoxypyridazin-3-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(-c2cccc(NS(=O)(=O)c3cccs3)c2)nn1 |
| InChI | InChI=1S/C15H13N3O3S2/c1-21-14-8-7-13(16-17-14)11-4-2-5-12(10-11)18-23(19,20)15-6-3-9-22-15/h2-10,18H,1H3 |
| InChIKey | MYDNXBBLTYCDQX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |