C23H23N3O4S — CID 122283503
2,4-diethoxy-N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)benzenesulfonamide (PubChem CID 122283503) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is 2,4-diethoxy-N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)benzenesulfonamide.
| Compound Name | 2,4-diethoxy-N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122283503 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2,4-diethoxy-N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(-c3cn4ccccc4n3)c2)c(OCC)c1 |
| InChI | InChI=1S/C23H23N3O4S/c1-3-29-19-11-12-22(21(15-19)30-4-2)31(27,28)25-18-9-7-8-17(14-18)20-16-26-13-6-5-10-23(26)24-20/h5-16,25H,3-4H2,1-2H3 |
| InChIKey | VIAINKCWQZZZRY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |