C24H24N4O4S — CID 25430428
3-[(4-ethoxyphenyl)sulfonylamino]-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide (PubChem CID 25430428) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 3-[(4-ethoxyphenyl)sulfonylamino]-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide.
| Compound Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 25430428 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(C(=O)NCCc3cn4ccccc4n3)c2)cc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-2-32-21-9-11-22(12-10-21)33(30,31)27-19-7-5-6-18(16-19)24(29)25-14-13-20-17-28-15-4-3-8-23(28)26-20/h3-12,15-17,27H,2,13-14H2,1H3,(H,25,29) |
| InChIKey | REDOJCDTVARKAF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |