C26H28N4O3S — CID 32831947
3-[(4-butylphenyl)sulfamoyl]-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide (PubChem CID 32831947) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is 3-[(4-butylphenyl)sulfamoyl]-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide.
| Compound Name | 3-[(4-butylphenyl)sulfamoyl]-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 32831947 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 3-[(4-butylphenyl)sulfamoyl]-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide |
| SMILES | CCCCc1ccc(NS(=O)(=O)c2cccc(C(=O)NCCc3cn4ccccc4n3)c2)cc1 |
| InChI | InChI=1S/C26H28N4O3S/c1-2-3-7-20-11-13-22(14-12-20)29-34(32,33)24-9-6-8-21(18-24)26(31)27-16-15-23-19-30-17-5-4-10-25(30)28-23/h4-6,8-14,17-19,29H,2-3,7,15-16H2,1H3,(H,27,31) |
| InChIKey | PLTFMYVJBVEFAH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |