C25H35N3O3S — CID 55387130
3-[(4-butylphenyl)sulfamoyl]-N-(1-propylpiperidin-4-yl)benzamide (PubChem CID 55387130) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is 3-[(4-butylphenyl)sulfamoyl]-N-(1-propylpiperidin-4-yl)benzamide.
| Compound Name | 3-[(4-butylphenyl)sulfamoyl]-N-(1-propylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 55387130 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 3-[(4-butylphenyl)sulfamoyl]-N-(1-propylpiperidin-4-yl)benzamide |
| SMILES | CCCCc1ccc(NS(=O)(=O)c2cccc(C(=O)NC3CCN(CCC)CC3)c2)cc1 |
| InChI | InChI=1S/C25H35N3O3S/c1-3-5-7-20-10-12-23(13-11-20)27-32(30,31)24-9-6-8-21(19-24)25(29)26-22-14-17-28(16-4-2)18-15-22/h6,8-13,19,22,27H,3-5,7,14-18H2,1-2H3,(H,26,29) |
| InChIKey | RHQYJGDGCNIANF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |