C20H26N4O3S — CID 55628674
N-(1-propylpiperidin-4-yl)-4-(pyridin-4-ylsulfamoyl)benzamide (PubChem CID 55628674) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-(1-propylpiperidin-4-yl)-4-(pyridin-4-ylsulfamoyl)benzamide.
| Compound Name | N-(1-propylpiperidin-4-yl)-4-(pyridin-4-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55628674 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-(1-propylpiperidin-4-yl)-4-(pyridin-4-ylsulfamoyl)benzamide |
| SMILES | CCCN1CCC(NC(=O)c2ccc(S(=O)(=O)Nc3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C20H26N4O3S/c1-2-13-24-14-9-17(10-15-24)22-20(25)16-3-5-19(6-4-16)28(26,27)23-18-7-11-21-12-8-18/h3-8,11-12,17H,2,9-10,13-15H2,1H3,(H,21,23)(H,22,25) |
| InChIKey | XSGHVNKHMJUOET-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |