C22H28BrN3O3S — CID 55386926
3-[(2-bromo-5-methylphenyl)sulfamoyl]-N-(1-propylpiperidin-4-yl)benzamide (PubChem CID 55386926) has the molecular formula C22H28BrN3O3S and a molecular weight of 494.46 g/mol. Its IUPAC name is 3-[(2-bromo-5-methylphenyl)sulfamoyl]-N-(1-propylpiperidin-4-yl)benzamide.
| Compound Name | 3-[(2-bromo-5-methylphenyl)sulfamoyl]-N-(1-propylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 55386926 |
| Molecular Formula | C22H28BrN3O3S |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 3-[(2-bromo-5-methylphenyl)sulfamoyl]-N-(1-propylpiperidin-4-yl)benzamide |
| SMILES | CCCN1CCC(NC(=O)c2cccc(S(=O)(=O)Nc3cc(C)ccc3Br)c2)CC1 |
| InChI | InChI=1S/C22H28BrN3O3S/c1-3-11-26-12-9-18(10-13-26)24-22(27)17-5-4-6-19(15-17)30(28,29)25-21-14-16(2)7-8-20(21)23/h4-8,14-15,18,25H,3,9-13H2,1-2H3,(H,24,27) |
| InChIKey | YMPIYAYYODOFDP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |