C21H26BrN3O3S — CID 60519873
3-[(2-bromo-5-methylphenyl)sulfamoyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzamide (PubChem CID 60519873) has the molecular formula C21H26BrN3O3S and a molecular weight of 480.43 g/mol. Its IUPAC name is 3-[(2-bromo-5-methylphenyl)sulfamoyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzamide.
| Compound Name | 3-[(2-bromo-5-methylphenyl)sulfamoyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 60519873 |
| Molecular Formula | C21H26BrN3O3S |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 3-[(2-bromo-5-methylphenyl)sulfamoyl]-N-[(1-ethylpyrrolidin-2-yl)methyl]benzamide |
| SMILES | CCN1CCCC1CNC(=O)c1cccc(S(=O)(=O)Nc2cc(C)ccc2Br)c1 |
| InChI | InChI=1S/C21H26BrN3O3S/c1-3-25-11-5-7-17(25)14-23-21(26)16-6-4-8-18(13-16)29(27,28)24-20-12-15(2)9-10-19(20)22/h4,6,8-10,12-13,17,24H,3,5,7,11,14H2,1-2H3,(H,23,26) |
| InChIKey | CRSWQUQSHKIVLQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |