C20H25BrN2O5S — CID 43007132
3-[(2-bromo-5-methylphenyl)sulfamoyl]-N,N-bis(2-methoxyethyl)benzamide (PubChem CID 43007132) has the molecular formula C20H25BrN2O5S and a molecular weight of 485.40 g/mol. Its IUPAC name is 3-[(2-bromo-5-methylphenyl)sulfamoyl]-N,N-bis(2-methoxyethyl)benzamide.
| Compound Name | 3-[(2-bromo-5-methylphenyl)sulfamoyl]-N,N-bis(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 43007132 |
| Molecular Formula | C20H25BrN2O5S |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 3-[(2-bromo-5-methylphenyl)sulfamoyl]-N,N-bis(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCOC)C(=O)c1cccc(S(=O)(=O)Nc2cc(C)ccc2Br)c1 |
| InChI | InChI=1S/C20H25BrN2O5S/c1-15-7-8-18(21)19(13-15)22-29(25,26)17-6-4-5-16(14-17)20(24)23(9-11-27-2)10-12-28-3/h4-8,13-14,22H,9-12H2,1-3H3 |
| InChIKey | LUCIHTHFKVNZFA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |