C19H21N3O3 — CID 42017579
2-(4-ethoxyphenoxy)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)acetamide (PubChem CID 42017579) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)acetamide.
| Compound Name | 2-(4-ethoxyphenoxy)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 42017579 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)acetamide |
| SMILES | CCOc1ccc(OCC(=O)NCCc2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-2-24-16-6-8-17(9-7-16)25-14-19(23)20-11-10-15-13-22-12-4-3-5-18(22)21-15/h3-9,12-13H,2,10-11,14H2,1H3,(H,20,23) |
| InChIKey | NKESXMJMZXTHJH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |