C22H16N4O2S — CID 122283305
N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)quinoline-8-sulfonamide (PubChem CID 122283305) has the molecular formula C22H16N4O2S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)quinoline-8-sulfonamide.
| Compound Name | N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 122283305 |
| Molecular Formula | C22H16N4O2S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2cn3ccccc3n2)c1)c1cccc2cccnc12 |
| InChI | InChI=1S/C22H16N4O2S/c27-29(28,20-10-4-6-16-8-5-12-23-22(16)20)25-18-9-3-7-17(14-18)19-15-26-13-2-1-11-21(26)24-19/h1-15,25H |
| InChIKey | JCONURVTGMEMIT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |