C22H17N5O2S — CID 122285761
N-[3-(3-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]quinoline-8-sulfonamide (PubChem CID 122285761) has the molecular formula C22H17N5O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is N-[3-(3-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[3-(3-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 122285761 |
| Molecular Formula | C22H17N5O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[3-(3-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]quinoline-8-sulfonamide |
| SMILES | Cc1c(-c2cccc(NS(=O)(=O)c3cccc4cccnc34)c2)nc2ncccn12 |
| InChI | InChI=1S/C22H17N5O2S/c1-15-20(25-22-24-12-5-13-27(15)22)17-7-2-9-18(14-17)26-30(28,29)19-10-3-6-16-8-4-11-23-21(16)19/h2-14,26H,1H3 |
| InChIKey | KGWHLQMFMXRQLK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |