C32H28Cl2N6O3 — CID 130230343
2-chloro-N-[4-chloro-3-[6-(dimethylamino)-1H-benzimidazol-2-yl]phenyl]-4-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]anilino]methyl]benzamide (PubChem CID 130230343) has the molecular formula C32H28Cl2N6O3 and a molecular weight of 615.52 g/mol. Its IUPAC name is 2-chloro-N-[4-chloro-3-[6-(dimethylamino)-1H-benzimidazol-2-yl]phenyl]-4-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]anilino]methyl]benzamide.
| Compound Name | 2-chloro-N-[4-chloro-3-[6-(dimethylamino)-1H-benzimidazol-2-yl]phenyl]-4-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]anilino]methyl]benzamide |
|---|---|
| PubChem CID | 130230343 |
| Molecular Formula | C32H28Cl2N6O3 |
| Molecular Weight | 615.52 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | 2-chloro-N-[4-chloro-3-[6-(dimethylamino)-1H-benzimidazol-2-yl]phenyl]-4-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]anilino]methyl]benzamide |
| SMILES | CN(C)c1ccc2nc(-c3cc(NC(=O)c4ccc(CNc5ccc(/C=C/C(=O)NO)cc5)cc4Cl)ccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C32H28Cl2N6O3/c1-40(2)23-10-13-28-29(17-23)38-31(37-28)25-16-22(9-12-26(25)33)36-32(42)24-11-5-20(15-27(24)34)18-35-21-7-3-19(4-8-21)6-14-30(41)39-43/h3-17,35,43H,18H2,1-2H3,(H,36,42)(H,37,38)(H,39,41)/b14-6+ |
| InChIKey | UWLLFLINMYIWFG-MKMNVTDBSA-N |
| XLogP | 6.99 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|