C17H17Cl2N3O — CID 56777594
(E)-N'-(3,4-dichlorophenyl)-3-[4-(dimethylamino)phenyl]prop-2-enehydrazide (PubChem CID 56777594) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is (E)-N'-(3,4-dichlorophenyl)-3-[4-(dimethylamino)phenyl]prop-2-enehydrazide.
| Compound Name | (E)-N'-(3,4-dichlorophenyl)-3-[4-(dimethylamino)phenyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 56777594 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (E)-N'-(3,4-dichlorophenyl)-3-[4-(dimethylamino)phenyl]prop-2-enehydrazide |
| SMILES | CN(C)c1ccc(/C=C/C(=O)NNc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O/c1-22(2)14-7-3-12(4-8-14)5-10-17(23)21-20-13-6-9-15(18)16(19)11-13/h3-11,20H,1-2H3,(H,21,23)/b10-5+ |
| InChIKey | ZNQYHZQVSNCAQI-BJMVGYQFSA-N |
| XLogP | 4.22 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|