C21H26N2O — CID 165078297
(1E,4E)-1-[4-(dimethylamino)phenyl]-5-[4-(methylamino)phenyl]penta-1,4-dien-3-one;methane (PubChem CID 165078297) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (1E,4E)-1-[4-(dimethylamino)phenyl]-5-[4-(methylamino)phenyl]penta-1,4-dien-3-one;methane.
| Compound Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-[4-(methylamino)phenyl]penta-1,4-dien-3-one;methane |
|---|---|
| PubChem CID | 165078297 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-[4-(methylamino)phenyl]penta-1,4-dien-3-one;methane |
| SMILES | C.CNc1ccc(/C=C/C(=O)/C=C/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O.CH4/c1-21-18-10-4-16(5-11-18)8-14-20(23)15-9-17-6-12-19(13-7-17)22(2)3;/h4-15,21H,1-3H3;1H4/b14-8+,15-9+; |
| InChIKey | URPDGMNRFPMSMJ-XAYJRMPLSA-N |
| XLogP | 4.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|