C17H17NOS — CID 52937238
(1E,4E)-1-[4-(dimethylamino)phenyl]-5-thiophen-2-ylpenta-1,4-dien-3-one (PubChem CID 52937238) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is (1E,4E)-1-[4-(dimethylamino)phenyl]-5-thiophen-2-ylpenta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-thiophen-2-ylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 52937238 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (1E,4E)-1-[4-(dimethylamino)phenyl]-5-thiophen-2-ylpenta-1,4-dien-3-one |
| SMILES | CN(C)c1ccc(/C=C/C(=O)/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C17H17NOS/c1-18(2)15-8-5-14(6-9-15)7-10-16(19)11-12-17-4-3-13-20-17/h3-13H,1-2H3/b10-7+,12-11+ |
| InChIKey | ZVGURLQSBFJQCS-OFJXCKHESA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|