C15H12O2S — CID 141350402
1-(2-hydroxyphenyl)-5-thiophen-2-ylpenta-1,4-dien-3-one (PubChem CID 141350402) has the molecular formula C15H12O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-5-thiophen-2-ylpenta-1,4-dien-3-one.
| Compound Name | 1-(2-hydroxyphenyl)-5-thiophen-2-ylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 141350402 |
| Molecular Formula | C15H12O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 1-(2-hydroxyphenyl)-5-thiophen-2-ylpenta-1,4-dien-3-one |
| SMILES | O=C(C=Cc1cccs1)C=Cc1ccccc1O |
| InChI | InChI=1S/C15H12O2S/c16-13(9-10-14-5-3-11-18-14)8-7-12-4-1-2-6-15(12)17/h1-11,17H |
| InChIKey | JNYOWHBCAIALOC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|