C17H14O3 — CID 6436784
(1Z,4E)-1,5-bis(2-hydroxyphenyl)penta-1,4-dien-3-one (PubChem CID 6436784) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (1Z,4E)-1,5-bis(2-hydroxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1Z,4E)-1,5-bis(2-hydroxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 6436784 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (1Z,4E)-1,5-bis(2-hydroxyphenyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C\c1ccccc1O)/C=C/c1ccccc1O |
| InChI | InChI=1S/C17H14O3/c18-15(11-9-13-5-1-3-7-16(13)19)12-10-14-6-2-4-8-17(14)20/h1-12,19-20H/b11-9-,12-10+ |
| InChIKey | YNVAHBUBGBLIEY-DSOJMZEYSA-N |
| XLogP | 3.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|