C11H8O5 — CID 102322322
(E)-5-(2-hydroxyphenyl)-2,3-dioxopent-4-enoic acid (PubChem CID 102322322) has the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. Its IUPAC name is (E)-5-(2-hydroxyphenyl)-2,3-dioxopent-4-enoic acid.
| Compound Name | (E)-5-(2-hydroxyphenyl)-2,3-dioxopent-4-enoic acid |
|---|---|
| PubChem CID | 102322322 |
| Molecular Formula | C11H8O5 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (E)-5-(2-hydroxyphenyl)-2,3-dioxopent-4-enoic acid |
| SMILES | O=C(O)C(=O)C(=O)/C=C/c1ccccc1O |
| InChI | InChI=1S/C11H8O5/c12-8-4-2-1-3-7(8)5-6-9(13)10(14)11(15)16/h1-6,12H,(H,15,16)/b6-5+ |
| InChIKey | KZUQMIGPEQQIBS-AATRIKPKSA-N |
| XLogP | 0.63 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|