C12H12O3 — CID 91017486
6-(2-hydroxyphenyl)hex-5-ene-2,4-dione (PubChem CID 91017486) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 6-(2-hydroxyphenyl)hex-5-ene-2,4-dione.
| Compound Name | 6-(2-hydroxyphenyl)hex-5-ene-2,4-dione |
|---|---|
| PubChem CID | 91017486 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 6-(2-hydroxyphenyl)hex-5-ene-2,4-dione |
| SMILES | CC(=O)CC(=O)C=Cc1ccccc1O |
| InChI | InChI=1S/C12H12O3/c1-9(13)8-11(14)7-6-10-4-2-3-5-12(10)15/h2-7,15H,8H2,1H3 |
| InChIKey | YRFOSQQBTYTIOI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|