C19H16O5 — CID 155518714
(1E,6E)-1-(2,5-dihydroxyphenyl)-7-(3-hydroxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 155518714) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is (1E,6E)-1-(2,5-dihydroxyphenyl)-7-(3-hydroxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(2,5-dihydroxyphenyl)-7-(3-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 155518714 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (1E,6E)-1-(2,5-dihydroxyphenyl)-7-(3-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C/c1cccc(O)c1)CC(=O)/C=C/c1cc(O)ccc1O |
| InChI | InChI=1S/C19H16O5/c20-15-3-1-2-13(10-15)4-6-17(22)12-18(23)7-5-14-11-16(21)8-9-19(14)24/h1-11,20-21,24H,12H2/b6-4+,7-5+ |
| InChIKey | TZDHOTPVURCYKT-YDFGWWAZSA-N |
| XLogP | 3.06 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|