C17H14O6 — CID 155555075
(E)-1-(2,3-dihydroxyphenyl)-5-(2,5-dihydroxyphenyl)pent-4-ene-1,3-dione (PubChem CID 155555075) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is (E)-1-(2,3-dihydroxyphenyl)-5-(2,5-dihydroxyphenyl)pent-4-ene-1,3-dione.
| Compound Name | (E)-1-(2,3-dihydroxyphenyl)-5-(2,5-dihydroxyphenyl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 155555075 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (E)-1-(2,3-dihydroxyphenyl)-5-(2,5-dihydroxyphenyl)pent-4-ene-1,3-dione |
| SMILES | O=C(/C=C/c1cc(O)ccc1O)CC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C17H14O6/c18-11-6-7-14(20)10(8-11)4-5-12(19)9-16(22)13-2-1-3-15(21)17(13)23/h1-8,18,20-21,23H,9H2/b5-4+ |
| InChIKey | IJYIXNLSLNXJIB-SNAWJCMRSA-N |
| XLogP | 2.36 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|