C15H11ClO4 — CID 52916523
1-(2-chlorophenyl)-3-(2,4-dihydroxyphenyl)propane-1,3-dione (PubChem CID 52916523) has the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(2,4-dihydroxyphenyl)propane-1,3-dione.
| Compound Name | 1-(2-chlorophenyl)-3-(2,4-dihydroxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 52916523 |
| Molecular Formula | C15H11ClO4 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(2,4-dihydroxyphenyl)propane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccccc1Cl)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H11ClO4/c16-12-4-2-1-3-10(12)14(19)8-15(20)11-6-5-9(17)7-13(11)18/h1-7,17-18H,8H2 |
| InChIKey | PTWPVSYFRKZPNM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|