C14H10ClFO3 — CID 800932
2-(2-chloro-6-fluorophenyl)-1-(2,4-dihydroxyphenyl)ethanone (PubChem CID 800932) has the molecular formula C14H10ClFO3 and a molecular weight of 280.68 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-(2,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-(2,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 800932 |
| Molecular Formula | C14H10ClFO3 |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-(2,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(Cc1c(F)cccc1Cl)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H10ClFO3/c15-11-2-1-3-12(16)10(11)7-14(19)9-5-4-8(17)6-13(9)18/h1-6,17-18H,7H2 |
| InChIKey | ZDTYYXLZABVGDD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |