C14H9Cl2FO — CID 62500601
2-(2,6-dichlorophenyl)-1-(2-fluorophenyl)ethanone (PubChem CID 62500601) has the molecular formula C14H9Cl2FO and a molecular weight of 283.13 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(2-fluorophenyl)ethanone.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 62500601 |
| Molecular Formula | C14H9Cl2FO |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)c1ccccc1F |
| InChI | InChI=1S/C14H9Cl2FO/c15-11-5-3-6-12(16)10(11)8-14(18)9-4-1-2-7-13(9)17/h1-7H,8H2 |
| InChIKey | UHPCTIAEVCUTMN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |