C15H11Cl2FO — CID 55187917
2-(2,6-dichlorophenyl)-1-(5-fluoro-2-methylphenyl)ethanone (PubChem CID 55187917) has the molecular formula C15H11Cl2FO and a molecular weight of 297.16 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(5-fluoro-2-methylphenyl)ethanone.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(5-fluoro-2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 55187917 |
| Molecular Formula | C15H11Cl2FO |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(5-fluoro-2-methylphenyl)ethanone |
| SMILES | Cc1ccc(F)cc1C(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H11Cl2FO/c1-9-5-6-10(18)7-11(9)15(19)8-12-13(16)3-2-4-14(12)17/h2-7H,8H2,1H3 |
| InChIKey | JKWTUMHRBRMTSL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |