C14H7Cl2F3O — CID 107475686
1-(2-chloro-4,5-difluorophenyl)-2-(2-chloro-6-fluorophenyl)ethanone (PubChem CID 107475686) has the molecular formula C14H7Cl2F3O and a molecular weight of 319.11 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-2-(2-chloro-6-fluorophenyl)ethanone.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-2-(2-chloro-6-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 107475686 |
| Molecular Formula | C14H7Cl2F3O |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-2-(2-chloro-6-fluorophenyl)ethanone |
| SMILES | O=C(Cc1c(F)cccc1Cl)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H7Cl2F3O/c15-9-2-1-3-11(17)7(9)5-14(20)8-4-12(18)13(19)6-10(8)16/h1-4,6H,5H2 |
| InChIKey | OUAGTIGPNIYEDF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|