C10H7ClO5 — CID 91006990
4-(2-chloro-4-hydroxyphenyl)-2,4-dioxobutanoic acid (PubChem CID 91006990) has the molecular formula C10H7ClO5 and a molecular weight of 242.61 g/mol. Its IUPAC name is 4-(2-chloro-4-hydroxyphenyl)-2,4-dioxobutanoic acid.
| Compound Name | 4-(2-chloro-4-hydroxyphenyl)-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 91006990 |
| Molecular Formula | C10H7ClO5 |
| Molecular Weight | 242.61 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 4-(2-chloro-4-hydroxyphenyl)-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1ccc(O)cc1Cl |
| InChI | InChI=1S/C10H7ClO5/c11-7-3-5(12)1-2-6(7)8(13)4-9(14)10(15)16/h1-3,12H,4H2,(H,15,16) |
| InChIKey | ATCLPSAPHMSEKL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.61 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|