C11H12O4 — CID 6441630
ethyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate (PubChem CID 6441630) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is ethyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6441630 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | ethyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(O)ccc1O |
| InChI | InChI=1S/C11H12O4/c1-2-15-11(14)6-3-8-7-9(12)4-5-10(8)13/h3-7,12-13H,2H2,1H3/b6-3+ |
| InChIKey | VNBYFUWBOIEPCR-ZZXKWVIFSA-N |
| XLogP | 1.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|