C13H16O5 — CID 174504187
ethyl 3-(4-hydroxy-2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 174504187) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl 3-(4-hydroxy-2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | ethyl 3-(4-hydroxy-2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 174504187 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | ethyl 3-(4-hydroxy-2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(O)c(OC)c1OC |
| InChI | InChI=1S/C13H16O5/c1-4-18-11(15)8-6-9-5-7-10(14)13(17-3)12(9)16-2/h5-8,14H,4H2,1-3H3 |
| InChIKey | KLOYNJWZFBONLT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|