C13H10F6O3 — CID 87973811
ethyl (Z)-3-[4-hydroxy-2,3-bis(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 87973811) has the molecular formula C13H10F6O3 and a molecular weight of 328.21 g/mol. Its IUPAC name is ethyl (Z)-3-[4-hydroxy-2,3-bis(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[4-hydroxy-2,3-bis(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 87973811 |
| Molecular Formula | C13H10F6O3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | ethyl (Z)-3-[4-hydroxy-2,3-bis(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\c1ccc(O)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C13H10F6O3/c1-2-22-9(21)6-4-7-3-5-8(20)11(13(17,18)19)10(7)12(14,15)16/h3-6,20H,2H2,1H3/b6-4- |
| InChIKey | IRKRVOGEFCMJNF-XQRVVYSFSA-N |
| XLogP | 4.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|