C13H11F3O4 — CID 169481061
4-(3-ethoxy-3-oxoprop-1-enyl)-3-(trifluoromethyl)benzoic acid (PubChem CID 169481061) has the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. Its IUPAC name is 4-(3-ethoxy-3-oxoprop-1-enyl)-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(3-ethoxy-3-oxoprop-1-enyl)-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 169481061 |
| Molecular Formula | C13H11F3O4 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-(3-ethoxy-3-oxoprop-1-enyl)-3-(trifluoromethyl)benzoic acid |
| SMILES | CCOC(=O)C=Cc1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C13H11F3O4/c1-2-20-11(17)6-5-8-3-4-9(12(18)19)7-10(8)13(14,15)16/h3-7H,2H2,1H3,(H,18,19) |
| InChIKey | PMZIKXPOFIOQLI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|