C20H19F3N4O3 — CID 70111817
ethyl (E)-3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 70111817) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70111817 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | ethyl (E)-3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)c2cccc(N=C(N)N)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H19F3N4O3/c1-2-30-17(28)9-7-12-6-8-15(11-16(12)20(21,22)23)26-18(29)13-4-3-5-14(10-13)27-19(24)25/h3-11H,2H2,1H3,(H,26,29)(H4,24,25,27)/b9-7+ |
| InChIKey | SBBWAPZXVNDATE-VQHVLOKHSA-N |
| XLogP | 3.44 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|